
CAS 1025023-08-8
:Glycine, N2-[(1,1-dimethylethoxy)carbonyl]-L-arginyl-, hydrochloride (1:1)
Description:
Glycine, N2-[(1,1-dimethylethoxy)carbonyl]-L-arginyl-, hydrochloride (1:1) is a synthetic compound that combines the amino acid glycine with a modified arginine residue. This compound features a dimethylethoxycarbonyl protecting group on the arginine side chain, which enhances its stability and solubility in various solvents. As a hydrochloride salt, it is typically more soluble in water, making it suitable for biological applications. The presence of both amino and carboxyl functional groups contributes to its zwitterionic nature, allowing it to participate in various biochemical reactions. This compound may be utilized in peptide synthesis, drug formulation, or as a biochemical reagent due to its ability to mimic natural amino acids. Its specific properties, such as melting point, solubility, and reactivity, can vary based on the conditions and the presence of other substances. Overall, this compound is of interest in pharmaceutical and biochemical research, particularly in the development of peptide-based therapeutics.
Formula:C13H25N5O5·ClH
InChI:InChI=1S/C13H25N5O5.ClH/c1-13(2,3)23-12(22)18-8(5-4-6-16-11(14)15)10(21)17-7-9(19)20;/h8H,4-7H2,1-3H3,(H,17,21)(H,18,22)(H,19,20)(H4,14,15,16);1H/t8-;/m0./s1
InChI key:InChIKey=LXAXUNQYMBWRLC-QRPNPIFTSA-N
SMILES:[C@@H](NC(OC(C)(C)C)=O)(C(NCC(O)=O)=O)CCCNC(=N)N.Cl
Synonyms:- Glycine, N2-[(1,1-dimethylethoxy)carbonyl]-L-arginyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.