
CAS 1025058-91-6
:2-[(2,4-Dichlorobenzoyl)amino]-4-(methylsulfonyl)butanoic acid
Description:
2-[(2,4-Dichlorobenzoyl)amino]-4-(methylsulfonyl)butanoic acid, identified by its CAS number 1025058-91-6, is a synthetic organic compound characterized by its complex structure, which includes a butanoic acid backbone substituted with a dichlorobenzoyl group and a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while the sulfonyl group may enhance its reactivity and interaction with biological systems. The dichlorobenzoyl moiety contributes to its potential as a bioactive agent, possibly influencing its pharmacological properties. The presence of chlorine atoms in the structure may also impart unique electronic characteristics, affecting its stability and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific biological activities or therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H13Cl2NO5S
InChI:InChI=1S/C12H13Cl2NO5S/c1-21(19,20)5-4-10(12(17)18)15-11(16)8-3-2-7(13)6-9(8)14/h2-3,6,10H,4-5H2,1H3,(H,15,16)(H,17,18)
InChI key:InChIKey=URWHVFRTJGXWAS-UHFFFAOYSA-N
SMILES:C(NC(CCS(C)(=O)=O)C(O)=O)(=O)C1=C(Cl)C=C(Cl)C=C1
Synonyms:- 2-[(2,4-Dichlorobenzoyl)amino]-4-(methylsulfonyl)butanoic acid
- Butanoic acid, 2-[(2,4-dichlorobenzoyl)amino]-4-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.