CAS 1025059-06-6
:3-Amino-6-chloro-1,3-dihydro-2H-indol-2-one
Description:
3-Amino-6-chloro-1,3-dihydro-2H-indol-2-one is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features an amino group (-NH2) and a chloro substituent (-Cl) at the 3 and 6 positions, respectively, contributing to its reactivity and potential biological activity. The presence of the dihydro form indicates that it has a saturated bond in the indole system, which can influence its stability and interaction with other molecules. This compound may exhibit properties such as solubility in polar solvents, and its functional groups suggest potential for hydrogen bonding and participation in various chemical reactions. It is of interest in medicinal chemistry, particularly for its potential applications in drug development, due to the biological significance of indole derivatives. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen and amino functionalities.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c9-4-1-2-5-6(3-4)11-8(12)7(5)10/h1-3,7H,10H2,(H,11,12)
InChI key:InChIKey=WTHRYAWCOFANQC-UHFFFAOYSA-N
SMILES:NC1C=2C(NC1=O)=CC(Cl)=CC2
Synonyms:- 3-Amino-6-chloro-1,3-dihydro-2H-indol-2-one
- 2H-Indol-2-one, 3-amino-6-chloro-1,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Amino-6-chloro-1,3-dihydro-2H-Indol-2-one
CAS:Controlled ProductFormula:C8H7ClN2OColor and Shape:NeatMolecular weight:182.607
