CAS 102507-85-7
:( Z )-2-(2-Aminothiazol-4-yl)-2-(1-carboxy-1-methyl)ethoxyiminoacetic acid
Description:
The chemical substance known as (Z)-2-(2-Aminothiazol-4-yl)-2-(1-carboxy-1-methyl)ethoxyiminoacetic acid, with the CAS number 102507-85-7, is characterized by its complex molecular structure, which includes a thiazole ring, an amino group, and an ethoxyiminoacetic acid moiety. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents due to the presence of functional groups like carboxylic acid and amino groups. Its stereochemistry is indicated by the (Z) configuration, suggesting specific spatial arrangements that can influence its biological activity and interactions. The presence of the thiazole ring often contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, including those typical of amino acids and carboxylic acids, which could be relevant for its synthesis and applications in drug development or biochemical research. Overall, this substance represents a unique combination of structural features that may confer specific reactivity and biological significance.
Formula:C9H11N3O5S
InChI:InChI=1/C9H11N3O5S/c1-9(2,7(15)16)17-12-5(6(13)14)4-3-18-8(10)11-4/h3H,1-2H3,(H2,10,11)(H,13,14)(H,15,16)/b12-5-
SMILES:CC(C)(C(=O)O)O/N=C(/c1csc(=N)[nH]1)\C(=O)O
Synonyms:- 2-({[(Z)-(2-Amino-1,3-thiazol-4-yl)(carboxy)methylene]amino}oxy)-2-methylpropanoic acid
- 2-({[(Z)-(2-amino-1,3-thiazol-4-yl)(carboxy)methylidene]amino}oxy)-2-methylpropanoic acid
- 4-thiazoleacetic acid, 2-amino-alpha-[(1-carboxy-1-methylethoxy)imino]-, (alphaZ)-
- 2-({[(1Z)-(2-amino-1,3-thiazol-4-yl)(carboxy)methylidene]amino}oxy)-2-methylpropanoic acid
- (Z)-2-(2-Aminothiazol-4-yl)-2-(1-carboxy-1-methyl)ethoxyiminoacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-2-((((2-Aminothiazol-4-yl)(carboxy)methylene)amino)oxy)-2-methylpropanoic acid
CAS:Formula:C9H11N3O5SColor and Shape:SolidMolecular weight:273.2657
