CAS 1025127-39-2

3-Amino-2-fluoro-5-hydroxybenzoic acid

Description:

3-Amino-2-fluoro-5-hydroxybenzoic acid is an organic compound characterized by the presence of an amino group, a fluorine atom, and a hydroxyl group attached to a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidity and solubility in polar solvents. The amino group (-NH2) typically imparts basic properties, while the hydroxyl group (-OH) can participate in hydrogen bonding, enhancing its solubility in water. The fluorine atom introduces unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research due to its potential biological activity, as modifications to the benzene ring can influence the pharmacokinetics and pharmacodynamics of drug candidates. Its structural characteristics suggest it could serve as a building block for more complex molecules or as a lead compound in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with functional groups that may pose health risks.

Formula: C₇H₆FNO₃

InChI: InChI=1S/C7H6FNO3/c8-6-4(7(11)12)1-3(10)2-5(6)9/h1-2,10H,9H2,(H,11,12)

InChI key: InChIKey=JUBGQPYIKIVBSG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C(N)=CC(O)=C1

Synonyms:

• Benzoic acid, 3-amino-2-fluoro-5-hydroxy-
• 3-Amino-2-fluoro-5-hydroxybenzoic acid

3-Amino-2-fluoro-5-hydroxybenzoic Acid

Controlled Product

CAS: 1025127-39-2

Formula: C₇H₆FNO₃

Color and Shape: Neat

Molecular weight: 171.126

Ref: TR-A591600