
CAS 1025127-47-2
:3-Amino-5-hydroxy-2-methylbenzoic acid
Description:
3-Amino-5-hydroxy-2-methylbenzoic acid, also known by its CAS number 1025127-47-2, is an organic compound characterized by the presence of an amino group (-NH2), a hydroxyl group (-OH), and a carboxylic acid group (-COOH) attached to a methyl-substituted benzene ring. This compound is a derivative of benzoic acid and exhibits both acidic and basic properties due to the functional groups present. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the hydroxyl group contributes to its reactivity and potential as a ligand in coordination chemistry. The methyl group provides steric hindrance, influencing the compound's overall reactivity and interaction with other molecules. This compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional versatility. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and the conditions under which it is studied.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-4-6(8(11)12)2-5(10)3-7(4)9/h2-3,10H,9H2,1H3,(H,11,12)
InChI key:InChIKey=ZCASNRKUQQRQIL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(N)=CC(O)=C1
Synonyms:- 3-Amino-5-hydroxy-2-methylbenzoic acid
- Benzoic acid, 3-amino-5-hydroxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.