CAS 10252-89-8

3-(5-chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol

Description:

3-(5-chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol, with the CAS number 10252-89-8, is a chemical compound characterized by its unique structure that includes a benzo[d]imidazole moiety and a propanol group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility and reactivity. The presence of the chlorine atom introduces electronegativity, potentially affecting the compound's biological activity and interaction with other molecules. As a benzoimidazole derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The hydroxyl group (-OH) in the propanol portion can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's stability and reactivity can be influenced by the substituents on the benzoimidazole ring. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₁ClN₂O

InChI: InChI=1/C10H11ClN2O/c11-7-3-4-8-9(6-7)13-10(12-8)2-1-5-14/h3-4,6,14H,1-2,5H2,(H,12,13)

SMILES: C(Cc1nc2ccc(cc2[nH]1)Cl)CO

Synonyms:

• 3-(6-chloro-1H-benzimidazol-2-yl)propan-1-ol

3-(5-Chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol

CAS: 10252-89-8

Formula: C₁₀H₁₁ClN₂O

Molecular weight: 210.6601

Ref: IN-DA0007NH

3-(5-chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol

CAS: 10252-89-8

3-(5-chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol

Purity: ≥95%

Molecular weight: 210.66g/mol

Ref: 54-OR21351