CAS 102539-67-3

3-Methoxycyclopentanecarboxylic acid

Description:

3-Methoxycyclopentanecarboxylic acid is an organic compound characterized by its cyclopentane ring structure, which is substituted with a methoxy group and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the methoxy group contributes to its polar nature, influencing its solubility in various solvents, particularly in polar solvents like alcohols and ethers. The carboxylic acid group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, 3-Methoxycyclopentanecarboxylic acid may exhibit interesting reactivity due to the combination of its functional groups, making it a potential candidate for various synthetic applications in organic chemistry. Its unique structure may also confer specific biological activities, which could be of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential hazards associated with its chemical properties.

Formula: C₇H₁₂O₃

InChI: InChI=1S/C7H12O3/c1-10-6-3-2-5(4-6)7(8)9/h5-6H,2-4H2,1H3,(H,8,9)

InChI key: InChIKey=PJEAKWXFTMRJMA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(OC)CC1

Synonyms:

• 3-Methoxycyclopentane-1-carboxylic acid
• Cyclopentanecarboxylic acid, 3-methoxy-
• 3-Methoxycyclopentanecarboxylic acid

3-Methoxycyclopentane-1-carboxylic acid

CAS: 102539-67-3

Versatile small molecule scaffold

Formula: C₇H₁₂O₃

Purity: Min. 95%

Molecular weight: 144.17 g/mol

Ref: 3D-CEA53967