CAS 102539-71-9
:tetrahydro-2H-pyran-3-ylacetic acid
Description:
Tetrahydro-2H-pyran-3-ylacetic acid is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and an acetic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. The presence of the tetrahydropyran ring contributes to its stability and potential reactivity, making it a useful intermediate in organic synthesis. Its acetic acid moiety allows for potential interactions with various biological systems, suggesting possible applications in pharmaceuticals or agrochemicals. The compound's properties, such as boiling point, melting point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c8-7(9)4-6-2-1-3-10-5-6/h6H,1-5H2,(H,8,9)
SMILES:C1CC(CC(=O)O)COC1
Synonyms:- 2H-pyran-3-acetic acid, tetrahydro-
- Tetrahydro-2H-pyran-3-ylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2H-Pyran-3-acetic acid, tetrahydro-
CAS:Formula:C7H12O3Purity:95%Color and Shape:LiquidMolecular weight:144.16842-(Tetrahydro-2H-pyran-3-yl)acetic acid
CAS:2-(Tetrahydro-2H-pyran-3-yl)acetic acidPurity:95%Molecular weight:144.17g/molTetrahydro-2H-pyran-3-ylacetic acid
CAS:<p>Tetrahydro-2H-pyran-3-ylacetic acid (THPA) is a chemical that is used as a reagent, speciality chemical and building block in the synthesis of more complex compounds. It is also used as a reaction component and intermediate in the synthesis of various pharmaceuticals. THPA has been shown to be an effective scaffold for creating new drugs that are useful in the treatment of diabetes, cancer and other diseases. This compound can be synthesized from cyclopentanone through a two step process involving oxidation and esterification.</p>Formula:C7H12O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:144.17 g/moltetrahydro-2H-pyran-3-ylacetic acid
CAS:Formula:C7H12O3Purity:95%Color and Shape:LiquidMolecular weight:144.17



