CymitQuimica logo

CAS 1025447-50-0

:

1H-Pyrazol-3-amine, 5-(4-methoxy-3,5-dimethylphenyl)-, hydrochloride (1:1)

Description:
1H-Pyrazol-3-amine, 5-(4-methoxy-3,5-dimethylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the 4-methoxy-3,5-dimethylphenyl substituent indicates that the compound has significant steric and electronic properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. The compound's CAS number, 1025447-50-0, allows for precise identification and facilitates research and regulatory processes. Overall, this substance represents a unique combination of a pyrazole derivative with specific substituents that may confer distinct chemical and biological properties.
Formula:C12H15N3O·ClH
InChI:InChI=1S/C12H15N3O.ClH/c1-7-4-9(5-8(2)12(7)16-3)10-6-11(13)15-14-10;/h4-6H,1-3H3,(H3,13,14,15);1H
InChI key:InChIKey=IQLLZKWLABPSJL-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(C)C1OC)C2=CC(N)=NN2.Cl
Synonyms:
  • 1H-Pyrazol-3-amine, 5-(4-methoxy-3,5-dimethylphenyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.