CAS 1025496-30-3

1-Methylpropyl 3-oxo-2-piperazineacetate

Description:

1-Methylpropyl 3-oxo-2-piperazineacetate, identified by its CAS number 1025496-30-3, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a methylpropyl group, an oxo group (indicating a carbonyl functional group), and an acetate moiety. The piperazine structure contributes to its potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. The presence of the oxo group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Additionally, the acetate group can influence the solubility and reactivity of the compound. Overall, 1-Methylpropyl 3-oxo-2-piperazineacetate may exhibit interesting properties that could be relevant in medicinal chemistry or material science, although specific applications and biological activities would require further investigation and characterization.

Formula: C₁₀H₁₈N₂O₃

InChI: InChI=1S/C10H18N2O3/c1-3-7(2)15-9(13)6-8-10(14)12-5-4-11-8/h7-8,11H,3-6H2,1-2H3,(H,12,14)

InChI key: InChIKey=YMTCHBJQWTUIGW-UHFFFAOYSA-N

SMILES: C(C(OC(CC)C)=O)C1C(=O)NCCN1

Synonyms:

• 1-Methylpropyl 3-oxo-2-piperazineacetate
• 2-Piperazineacetic acid, 3-oxo-, 1-methylpropyl ester