CymitQuimica logo

CAS 10255-14-8

:

N-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-aminium acetate

Description:
N-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-aminium acetate, commonly referred to as a quaternary ammonium compound, exhibits several notable characteristics. This substance is typically a white to off-white solid at room temperature and is soluble in water due to its ionic nature. It features a quaternary ammonium structure, which contributes to its surfactant properties, making it useful in various applications, including as a stabilizer or emulsifier in formulations. The presence of hydroxyl groups in its structure enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. Additionally, the compound may exhibit biological activity, potentially serving as an antioxidant or in other therapeutic roles due to the presence of the dihydroxyphenyl moiety. Its acetate salt form indicates that it can participate in acid-base reactions, further expanding its utility in chemical processes. Overall, this compound's unique structural features contribute to its diverse applications in both industrial and pharmaceutical contexts.
Formula:C14H23NO5
InChI:InChI=1/C12H19NO3.C2H4O2/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8;1-2(3)4/h4-6,11,13-16H,7H2,1-3H3;1H3,(H,3,4)
SMILES:CC(C)(C)NCC(c1ccc(c(c1)O)O)O.CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.