CAS 1025509-76-5

2,6-Dimethyl-4-pyridinesulfonyl chloride

Description:

2,6-Dimethyl-4-pyridinesulfonyl chloride is an organic compound characterized by its pyridine ring structure, which is substituted at the 2 and 6 positions with methyl groups and at the 4 position with a sulfonyl chloride group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the sulfonyl chloride functional group, which can undergo nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. The presence of the methyl groups contributes to its lipophilicity, potentially influencing its solubility in organic solvents. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 2,6-Dimethyl-4-pyridinesulfonyl chloride is a valuable intermediate in synthetic organic chemistry.

Formula: C₇H₈ClNO₂S

InChI: InChI=1S/C7H8ClNO2S/c1-5-3-7(12(8,10)11)4-6(2)9-5/h3-4H,1-2H3

InChI key: InChIKey=UHFNEOYZKVGGDV-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C(C)N=C(C)C1

Synonyms:

• 2,6-Dimethyl-4-pyridinesulfonyl chloride
• 4-Pyridinesulfonyl chloride, 2,6-dimethyl-
• 2,6-Dimethylpyridine-4-sulfonyl chloride