
CAS 1025556-12-0
:8-Hydroxy-6-quinolinecarbonitrile
Description:
8-Hydroxy-6-quinolinecarbonitrile, identified by its CAS number 1025556-12-0, is a chemical compound that features a quinoline core with a hydroxyl group and a cyano group. This compound is characterized by its heterocyclic structure, which contributes to its potential applications in various fields, including medicinal chemistry and materials science. The presence of the hydroxyl group enhances its solubility in polar solvents, while the cyano group can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, compounds of this nature often exhibit interesting biological activities, such as antimicrobial or antitumor properties, due to their ability to interact with biological targets. The compound's stability, reactivity, and functional groups make it a subject of interest for researchers exploring new pharmaceuticals or advanced materials. As with many chemical substances, safety data and handling precautions should be considered when working with 8-Hydroxy-6-quinolinecarbonitrile in laboratory settings.
Formula:C10H6N2O
InChI:InChI=1S/C10H6N2O/c11-6-7-4-8-2-1-3-12-10(8)9(13)5-7/h1-5,13H
InChI key:InChIKey=MKAFLHLIONROCG-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(C#N)C1)C=CC=N2
Synonyms:- 6-Quinolinecarbonitrile, 8-hydroxy-
- 8-Hydroxy-6-quinolinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.