CAS 102559-27-3
:4-{[5-(4-phenoxyphenoxy)pentyl]oxy}aniline
Description:
4-{[5-(4-phenoxyphenoxy)pentyl]oxy}aniline, with the CAS number 102559-27-3, is an organic compound characterized by its complex molecular structure, which includes an aniline moiety and a phenoxyphenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields such as materials science and pharmaceuticals. The presence of multiple aromatic rings suggests that it may possess significant stability and hydrophobic characteristics, while the aliphatic pentyl chain can enhance solubility in organic solvents. Additionally, the functional groups present in the molecule may allow for hydrogen bonding and other intermolecular interactions, influencing its reactivity and potential uses. Overall, this compound's unique structure may lead to interesting electronic and optical properties, making it a candidate for further research in organic synthesis and material development.
Formula:C23H25NO3
InChI:InChI=1/C23H25NO3/c24-19-9-11-20(12-10-19)25-17-5-2-6-18-26-21-13-15-23(16-14-21)27-22-7-3-1-4-8-22/h1,3-4,7-16H,2,5-6,17-18,24H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aniline, p-(5-(p-phenoxyphenoxy)pentyloxy)-
CAS:Aniline, p-(5-(p-phenoxyphenoxy)pentyloxy)- is a bioactive chemical.Formula:C23H25NO3Color and Shape:SolidMolecular weight:363.45
