CAS 1025664-36-1

B-[4-(1-Azetidinylcarbonyl)-3-fluorophenyl]boronic acid

Description:

B-[4-(1-Azetidinylcarbonyl)-3-fluorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a fluorophenyl moiety, which can influence its electronic properties and reactivity due to the presence of the electronegative fluorine atom. The azetidinylcarbonyl group contributes to the compound's structural complexity and may enhance its biological activity. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the boron atom allows for potential applications in drug delivery and molecular recognition. Overall, this compound exemplifies the diverse functionalities of boronic acids in chemical research and development.

Formula: C₁₀H₁₁BFNO₃

InChI: InChI=1S/C10H11BFNO3/c12-9-6-7(11(15)16)2-3-8(9)10(14)13-4-1-5-13/h2-3,6,15-16H,1,4-5H2

InChI key: InChIKey=XKMIWMCMPYRJCF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(B(O)O)C=C1)N2CCC2

Synonyms:

• Boronic acid, B-[4-(1-azetidinylcarbonyl)-3-fluorophenyl]-
• B-[4-(1-Azetidinylcarbonyl)-3-fluorophenyl]boronic acid