CAS 1025689-38-6

Ethyl 2-cyano-3-(2-pyrimidinylamino)-2-propenoate

Description:

Ethyl 2-cyano-3-(2-pyrimidinylamino)-2-propenoate, identified by its CAS number 1025689-38-6, is a chemical compound characterized by its unique structural features, which include a cyano group and a pyrimidinylamino moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of biologically active molecules. The presence of the cyano group contributes to its reactivity, allowing for various chemical transformations. Additionally, the pyrimidinylamino group may impart specific biological activities, making it of interest in drug discovery and development. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, Ethyl 2-cyano-3-(2-pyrimidinylamino)-2-propenoate is a versatile compound with significant potential in chemical research and pharmaceutical applications.

Formula: C₁₀H₁₀N₄O₂

InChI: InChI=1S/C10H10N4O2/c1-2-16-9(15)8(6-11)7-14-10-12-4-3-5-13-10/h3-5,7H,2H2,1H3,(H,12,13,14)

InChI key: InChIKey=AUAQMBYNADBTSX-UHFFFAOYSA-N

SMILES: N(C=C(C(OCC)=O)C#N)C=1N=CC=CN1

Synonyms:

• 2-Propenoic acid, 2-cyano-3-(2-pyrimidinylamino)-, ethyl ester
• Ethyl 2-cyano-3-(2-pyrimidinylamino)-2-propenoate

ethyl 2-nitrilo-3-(pyrimidin-2-ylamino)prop-2-enoate

CAS: 1025689-38-6

Please enquire for more information about ethyl 2-nitrilo-3-(pyrimidin-2-ylamino)prop-2-enoate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 218.21 g/mol

Ref: 3D-ARB68938