CAS 10257-31-5
:Xylopyranose
Description:
Xylopyranose is a sugar alcohol derived from xylose, a pentose monosaccharide. It is characterized by its six-membered pyranose ring structure, which includes five carbon atoms and one oxygen atom. This cyclic form is a common configuration for many sugars, contributing to its stability and reactivity. Xylopyranose is typically found in its D-form, which is biologically relevant. It is soluble in water due to the presence of multiple hydroxyl (-OH) groups, which facilitate hydrogen bonding. This solubility makes it useful in various applications, including food and pharmaceutical industries, where it can serve as a sweetener or a bulking agent. Additionally, xylopyranose can participate in various biochemical reactions, including fermentation processes, and may have potential health benefits, such as prebiotic effects. Its CAS number, 10257-31-5, is a unique identifier that helps in the cataloging and regulation of this compound in scientific literature and databases. Overall, xylopyranose is an important carbohydrate with diverse applications and biological significance.
Formula:C5H10O5
InChI:InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/s2
InChI key:InChIKey=SRBFZHDQGSBBOR-XXCDGEAYNA-N
SMILES:O[C@@H]1[C@@H](O)C(O)OC[C@H]1O
Synonyms:- Xylopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
