CAS 10257-32-6
:D-Ribopyranose
Description:
D-Ribopyranose is a monosaccharide, specifically a pentose sugar, that plays a crucial role in various biological processes, including nucleic acid metabolism. It is an aldohexose, meaning it contains an aldehyde group and has five carbon atoms in its structure. The pyranose form of D-ribose features a six-membered ring, which is formed through the reaction of the aldehyde group with one of the hydroxyl groups, resulting in a stable cyclic structure. D-Ribopyranose is known for its sweet taste and is soluble in water, making it readily available for biological functions. It is a key component of ribonucleic acid (RNA) and is involved in energy metabolism as part of adenosine triphosphate (ATP). The compound exhibits stereoisomerism, with specific configurations at its chiral centers, which are critical for its biological activity. Additionally, D-ribopyranose can participate in various chemical reactions, including oxidation and reduction, contributing to its versatility in biochemical pathways.
Formula:C5H10O5
InChI:InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4-,5?/m1/s1
InChI key:InChIKey=SRBFZHDQGSBBOR-SOOFDHNKSA-N
SMILES:O[C@H]1[C@@H](O)C(O)OC[C@H]1O
Synonyms:- D-Ribopyranose
- Ribopyranose, D-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
