CAS 1025707-99-6

1H-Pyrrole, 2,2′-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methylene]bis-

Description:

1H-Pyrrole, 2,2′-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methylene]bis- is a complex organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of the dioxaborinane moiety indicates that this compound has boron-containing functional groups, which can enhance its reactivity and potential applications in organic synthesis and materials science. The compound's structure suggests it may exhibit interesting electronic properties due to the conjugation between the pyrrole and the phenyl groups, potentially making it useful in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, the presence of dimethyl groups may influence its solubility and steric properties. Overall, this compound's unique structural features could lead to diverse applications in fields such as medicinal chemistry, polymer science, and catalysis. However, specific properties such as melting point, boiling point, and solubility would require experimental determination or detailed literature references.

Formula: C₂₀H₂₃BN₂O₂

InChI: InChI=1S/C20H23BN2O2/c1-20(2)13-24-21(25-14-20)16-9-7-15(8-10-16)19(17-5-3-11-22-17)18-6-4-12-23-18/h3-12,19,22-23H,13-14H2,1-2H3

InChI key: InChIKey=JWZNBORWRYAAFX-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C=C1)B2OCC(C)(C)CO2)(C3=CC=CN3)C4=CC=CN4

Synonyms:

• 2-[[4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole
• 1H-Pyrrole, 2,2′-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methylene]bis-

1H-Pyrrole, 2,2'-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methylene]bis-

CAS: 1025707-99-6

Formula: C₂₀H₂₃BN₂O₂

Molecular weight: 334.2198

Ref: IN-DA0007QO