
CAS 1025718-81-3
:N-[3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide
Description:
N-[3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro-substituted phenyl group and a boron-containing moiety. The presence of the dioxaborolane ring contributes to its potential reactivity and applications in organic synthesis, particularly in cross-coupling reactions. This compound is likely to exhibit moderate to high polarity due to the presence of both the amide and boron functionalities, which can influence its solubility in various solvents. Additionally, the chloro group may impart specific reactivity patterns, making it useful in further chemical transformations. The tetramethyl groups enhance the stability of the dioxaborolane, potentially affecting its reactivity and interactions with other chemical species. Overall, this compound may find applications in medicinal chemistry, materials science, and as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of chlorine and boron in its structure.
Formula:C14H19BClNO3
InChI:InChI=1S/C14H19BClNO3/c1-9(18)17-12-7-10(6-11(16)8-12)15-19-13(2,3)14(4,5)20-15/h6-8H,1-5H3,(H,17,18)
InChI key:InChIKey=TVEMSTCZYSMWJX-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(NC(C)=O)=CC(Cl)=C2
Synonyms:- N-[3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide
- Acetamide, N-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide
CAS:Formula:C14H19BClNO3Molecular weight:295.5696
