CAS 1025718-84-6
:3-Bromo-5-(trifluoromethyl)phenol
Description:
3-Bromo-5-(trifluoromethyl)phenol is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a phenolic structure. This compound features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and the substitution of bromine at the meta position (3) and a trifluoromethyl group at the para position (5). The trifluoromethyl group significantly influences the compound's electronic properties, making it more lipophilic and potentially enhancing its reactivity in various chemical reactions. The presence of the bromine atom can also impart unique characteristics, such as increased electrophilicity. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential biological activity and chemical reactivity. Additionally, its unique structure may allow for specific interactions in biological systems, making it of interest in medicinal chemistry. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C7H4BrF3O
InChI:InChI=1S/C7H4BrF3O/c8-5-1-4(7(9,10)11)2-6(12)3-5/h1-3,12H
SMILES:c1c(cc(cc1Br)O)C(F)(F)F
Synonyms:- 3-Bromo-5-Trifluoromethylphenol
- Phenol, 3-bromo-5-(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Phenol, 3-bromo-5-(trifluoromethyl)-
CAS:Formula:C7H4BrF3OPurity:97%Color and Shape:LiquidMolecular weight:241.00533-Bromo-5-hydroxybenzotrifluoride
CAS:3-Bromo-5-hydroxybenzotrifluorideFormula:C7H4BrF3OPurity:≥95%Color and Shape: clear. light orange liquidMolecular weight:241.01g/mol3-Bromo-5-(trifluoromethyl)phenol
CAS:3-Bromo-5-(trifluoromethyl)phenol is a versatile building block that is used as a scaffold for synthesis of complex compounds. It can be used as a reaction component in the synthesis of valuable chemical products, such as fine chemicals and research chemicals. 3-Bromo-5-(trifluoromethyl)phenol is also useful for the production of speciality chemicals. This chemical has been shown to have high quality and can be used as a reagent in organic synthesis.
Formula:C7H4BrF3OPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:241.01 g/mol3-Bromo-5-(trifluoromethyl)phenol
CAS:Formula:C7H4BrF3OPurity:95%Color and Shape:ClearMolecular weight:241.007



