CymitQuimica logo

CAS 1025718-93-7

:

Methyl 1,6-dihydro-4-hydroxy-6-oxo-2-pyridinecarboxylate

Description:
Methyl 1,6-dihydro-4-hydroxy-6-oxo-2-pyridinecarboxylate, identified by its CAS number 1025718-93-7, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring with various functional groups, including a hydroxyl group and a carboxylate ester, which contribute to its reactivity and potential applications in organic synthesis. The presence of the keto group enhances its electrophilic character, making it a candidate for various chemical reactions, such as nucleophilic additions. Its structural characteristics suggest potential biological activity, which may be explored in medicinal chemistry. The compound is typically characterized by its solubility in polar solvents, and its stability can vary depending on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C7H7NO4
InChI:InChI=1S/C7H7NO4/c1-12-7(11)5-2-4(9)3-6(10)8-5/h2-3H,1H3,(H2,8,9,10)
InChI key:InChIKey=BEZBFWYDZIMLAQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(O)=CC(=O)N1
Synonyms:
  • Methyl 1,6-dihydro-4-hydroxy-6-oxo-2-pyridinecarboxylate
  • 2-Pyridinecarboxylic acid, 1,6-dihydro-4-hydroxy-6-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.