CymitQuimica logo

CAS 1025719-02-1

:

Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylate

Description:
Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylate is an organic compound characterized by its unique structure, which includes a furan ring and a boron-containing moiety. The presence of the furan ring contributes to its aromatic properties, while the dioxaborolane group enhances its reactivity, particularly in organic synthesis and potential applications in medicinal chemistry. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (furan and alkyl groups) and hydrophilic (carboxylate and boron) components. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the boron atom can participate in various chemical reactions, such as cross-coupling reactions. Additionally, the compound may display interesting biological activities, although specific biological data would need to be investigated further. Overall, its unique structural features make it a candidate for further research in synthetic organic chemistry and related fields.
Formula:C13H19BO5
InChI:InChI=1S/C13H19BO5/c1-8-7-9(17-10(8)11(15)16-6)14-18-12(2,3)13(4,5)19-14/h7H,1-6H3
InChI key:InChIKey=ZWIICMVTKZBIFK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2OC(C(OC)=O)=C(C)C2
Synonyms:
  • Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylate
  • 2-Furancarboxylic acid, 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.