
CAS 1025724-60-0
:1-[[3-(Trifluoromethyl)phenyl]methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine
Description:
1-[[3-(Trifluoromethyl)phenyl]methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine is a complex organic compound characterized by its unique molecular structure, which includes a piperidine ring substituted with both trifluoromethylphenyl and pyrazole groups. The presence of trifluoromethyl groups enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The piperidine moiety contributes to the compound's potential as a pharmacophore, while the pyrazole ring may impart specific reactivity and binding properties. This compound is likely to exhibit significant interactions with biological targets, which could be explored for therapeutic applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed through various analytical methods. Overall, this compound represents a class of molecules that may have potential applications in drug discovery and development, particularly in areas targeting specific receptors or enzymes.
Formula:C23H21F6N3
InChI:InChI=1S/C23H21F6N3/c24-22(25,26)18-5-1-3-15(11-18)14-32-9-7-16(8-10-32)20-13-21(31-30-20)17-4-2-6-19(12-17)23(27,28)29/h1-6,11-13,16H,7-10,14H2,(H,30,31)
InChI key:InChIKey=OKWFAIAJKRBMPT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C2=CC(=NN2)C3CCN(CC4=CC(C(F)(F)F)=CC=C4)CC3)C=CC1
Synonyms:- 1-[[3-(Trifluoromethyl)phenyl]methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine
- Piperidine, 1-[[3-(trifluoromethyl)phenyl]methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.