
CAS 1025724-67-7
:1-[(4-Chlorophenyl)sulfonyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine
Description:
1-[(4-Chlorophenyl)sulfonyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine is a complex organic compound characterized by its unique structural features, which include a piperidine ring, a sulfonyl group, and a pyrazole moiety. The presence of the 4-chlorophenyl group contributes to its potential biological activity, while the trifluoromethyl group enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is typically synthesized through multi-step organic reactions, involving the formation of the piperidine and pyrazole rings, followed by sulfonylation. It may exhibit various properties such as solubility in organic solvents, stability under standard laboratory conditions, and potential reactivity with nucleophiles due to the sulfonyl group. The compound's specific applications may vary, but it is often investigated for its potential use in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C21H19ClF3N3O2S
InChI:InChI=1S/C21H19ClF3N3O2S/c22-17-4-6-18(7-5-17)31(29,30)28-10-8-14(9-11-28)19-13-20(27-26-19)15-2-1-3-16(12-15)21(23,24)25/h1-7,12-14H,8-11H2,(H,26,27)
InChI key:InChIKey=HDUMHBFIXDMBQJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C2=CC(=NN2)C3CCN(S(=O)(=O)C4=CC=C(Cl)C=C4)CC3)C=CC1
Synonyms:- 1-[(4-Chlorophenyl)sulfonyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine
- Piperidine, 1-[(4-chlorophenyl)sulfonyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.