CymitQuimica logo

CAS 1025736-41-7

:

Decyl 3-oxo-2-piperazineacetate

Description:
Decyl 3-oxo-2-piperazineacetate, identified by its CAS number 1025736-41-7, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a decyl group, a long-chain alkyl substituent that contributes to its hydrophobic properties, and an acetic acid derivative, which can influence its solubility and reactivity. The 3-oxo functional group indicates the presence of a ketone, suggesting potential reactivity in various chemical processes. Due to its structural features, Decyl 3-oxo-2-piperazineacetate may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other solvents or reagents. Overall, this compound's unique structure positions it as a potentially valuable substance in various applications, including drug development and synthesis.
Formula:C16H30N2O3
InChI:InChI=1S/C16H30N2O3/c1-2-3-4-5-6-7-8-9-12-21-15(19)13-14-16(20)18-11-10-17-14/h14,17H,2-13H2,1H3,(H,18,20)
InChI key:InChIKey=BWTLUCLWSUFUIC-UHFFFAOYSA-N
SMILES:C(C(OCCCCCCCCCC)=O)C1C(=O)NCCN1
Synonyms:
  • Decyl 3-oxo-2-piperazineacetate
  • 2-Piperazineacetic acid, 3-oxo-, decyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.