CAS 1025736-42-8

Dodecyl 3-oxo-2-piperazineacetate

Description:

Dodecyl 3-oxo-2-piperazineacetate, with the CAS number 1025736-42-8, is a chemical compound characterized by its unique structure that includes a dodecyl chain, a piperazine ring, and an acetate functional group. This compound typically exhibits amphiphilic properties due to the presence of both hydrophobic (dodecyl) and hydrophilic (acetate) components, making it useful in various applications such as surfactants, emulsifiers, and potentially in drug delivery systems. The piperazine moiety can contribute to biological activity, potentially enhancing interactions with biological membranes. Its molecular structure suggests it may have a moderate to high molecular weight, influencing its solubility and stability in different solvents. Additionally, the presence of the ketone group (3-oxo) may impart reactivity, allowing for further chemical modifications. Overall, Dodecyl 3-oxo-2-piperazineacetate is a versatile compound with potential applications in both industrial and pharmaceutical fields, although specific properties such as melting point, boiling point, and solubility would require empirical determination.

Formula: C₁₈H₃₄N₂O₃

InChI: InChI=1S/C18H34N2O3/c1-2-3-4-5-6-7-8-9-10-11-14-23-17(21)15-16-18(22)20-13-12-19-16/h16,19H,2-15H2,1H3,(H,20,22)

InChI key: InChIKey=RUKMGTJGNDECEQ-UHFFFAOYSA-N

SMILES: C(C(OCCCCCCCCCCCC)=O)C1C(=O)NCCN1

Synonyms:

• Dodecyl 3-oxo-2-piperazineacetate
• 2-Piperazineacetic acid, 3-oxo-, dodecyl ester