
CAS 102575-25-7
:Tricyclo[5.1.0.02,8]oct-4-ene
Description:
Tricyclo[5.1.0.02,8]oct-4-ene is a bicyclic organic compound characterized by its unique tricyclic structure, which consists of three interconnected rings. This compound features a double bond located at the 4-position of the octane framework, contributing to its unsaturation. The presence of multiple rings imparts significant strain to the molecule, influencing its reactivity and stability. Typically, compounds with such structures exhibit interesting chemical properties, including potential for ring-opening reactions and participation in various cycloaddition processes. Tricyclo[5.1.0.02,8]oct-4-ene may also display distinctive physical properties, such as a relatively low boiling point and specific solubility characteristics, depending on the functional groups present. Its unique arrangement makes it a subject of interest in synthetic organic chemistry, particularly in the development of novel materials and pharmaceuticals. As with many cyclic compounds, the stereochemistry and conformational dynamics can also play a crucial role in determining its chemical behavior and interactions with other substances.
Formula:C8H10
InChI:InChI=1S/C8H10/c1-2-4-6-7-5(3-1)8(6)7/h1-2,5-8H,3-4H2
InChI key:InChIKey=YVOQUDKKWLTNAV-UHFFFAOYSA-N
SMILES:C12C3C1CC=CCC23
Synonyms:- Tricyclo[5.1.0.02,8]oct-4-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
