CAS 102579-48-6

H-Gly-Phe-Gly-aldehyde semicarbazone

Description:

H-Gly-Phe-Gly-aldehyde semicarbazone, with the CAS number 102579-48-6, is a chemical compound formed from the reaction of semicarbazide with an aldehyde derivative of a dipeptide composed of glycine (Gly) and phenylalanine (Phe). This compound typically exhibits characteristics common to semicarbazones, such as the ability to form stable derivatives and potential biological activity. It may display solubility in polar solvents due to the presence of amino and carbonyl functional groups, which can engage in hydrogen bonding. The structure suggests that it may participate in various chemical reactions, including condensation and hydrolysis, and could be of interest in medicinal chemistry for its potential applications in drug development or as a biochemical probe. Additionally, the presence of the phenylalanine residue may impart specific interactions with biological targets, making it relevant in studies of enzyme inhibition or receptor binding. Overall, H-Gly-Phe-Gly-aldehyde semicarbazone represents a compound with diverse chemical properties and potential applications in research and pharmaceuticals.

Formula: C₁₄H₂₀N₆O₃

InChI: InChI=1/C14H20N6O3/c15-9-12(21)19-13(22)11(8-10-4-2-1-3-5-10)17-6-7-18-20-14(16)23/h1-5,7,11,17H,6,8-9,15H2,(H3,16,20,23)(H,19,21,22)/b18-7+/t11-/m0/s1

Synonyms:

• Glycyl-phenylalanyl-glycine-semicarbazone
• Gly-phe-gly-Sc
• Glycyl-phenylalanyl-glycylsemicarbazone
• N-(aminoacetyl)-Nalpha-[(2E)-2-(2-carbamoylhydrazinylidene)ethyl]-L-phenylalaninamide
• H-Gly-Phe-Gly-Aldehyde Semicarbazone Acetate Salt

H-Gly-Phe-Gly-aldehyde semicarbazone acetate salt

CAS: 102579-48-6

Please enquire for more information about H-Gly-Phe-Gly-aldehyde semicarbazone acetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₂₀N₆O₃

Purity: Min. 95%

Molecular weight: 320.35 g/mol

Ref: 3D-FG110196