
CAS 1025796-07-9
:7-Methyl-2,4(1H,3H)-quinolinedione
Description:
7-Methyl-2,4(1H,3H)-quinolinedione, also known as 7-methyl-1,4-dihydroquinoline-2,4-dione, is a heterocyclic organic compound characterized by a quinoline backbone with a methyl group at the 7-position and two carbonyl groups at the 2 and 4 positions. This compound typically exhibits a yellow to orange color and is soluble in organic solvents. It is known for its potential biological activities, including antimicrobial and antioxidant properties, making it of interest in pharmaceutical research. The presence of the quinoline structure contributes to its ability to interact with various biological targets. Additionally, the compound may undergo various chemical reactions, such as reduction or substitution, due to the reactivity of its carbonyl groups. Its unique structure and properties make it a valuable compound for further studies in medicinal chemistry and material science. As with many quinoline derivatives, safety and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-6-2-3-7-8(4-6)11-10(13)5-9(7)12/h2-4H,5H2,1H3,(H,11,13)
InChI key:InChIKey=UURDSPGRDMBHBB-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)C1)=CC(C)=CC2
Synonyms:- 7-Methyl-2,4(1H,3H)-quinolinedione
- 2,4(1H,3H)-Quinolinedione, 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.