CAS 102582-92-3
:tris-(2-hydroxyethyl)ammonium 4-fluorophenylsulfonylacetate
Description:
Tris-(2-hydroxyethyl)ammonium 4-fluorophenylsulfonylacetate, identified by its CAS number 102582-92-3, is a chemical compound characterized by its unique structure that includes a quaternary ammonium group and a sulfonylacetate moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl groups, which enhance its hydrophilicity. The fluorophenyl group contributes to its potential reactivity and may influence its electronic properties, making it useful in various chemical applications. Additionally, the presence of the sulfonyl group can impart acidic characteristics, which may affect its behavior in different pH environments. Tris-(2-hydroxyethyl)ammonium 4-fluorophenylsulfonylacetate may find applications in fields such as pharmaceuticals, materials science, and catalysis, where its unique functional groups can facilitate specific interactions or reactions. As with many chemical substances, safety and handling precautions should be observed, given its potential biological activity and reactivity.
Formula:C14H22FNO7S
InChI:InChI=1/C8H7FO4S.C6H15NO3/c9-6-1-3-7(4-2-6)14(12,13)5-8(10)11;8-4-1-7(2-5-9)3-6-10/h1-4H,5H2,(H,10,11);8-10H,1-6H2
SMILES:c1cc(ccc1F)S(=O)(=O)CC(=O)O.C(CO)N(CCO)CCO
Synonyms:- ((p-Fluorophenyl)sulfonyl)acetic acid compd. with 2,2',2''-nitrilotrisethanol (1:1)
- (p-Fluorophenylsulfonyl)acetic acid triethanolamine
- Ethanol, 2,2',2''-nitrilotris-, ((4-fluorophenyl)sulfonyl)acetate (salt)
- Acetic acid, ((p-fluorophenyl)sulfonyl)-, compd. with 2,2',2''-nitrilotrisethanol (1:1)
- [(4-Fluorophenyl)Sulfonyl]Acetic Acid - 2,2',2''-Nitrilotriethanol (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetic acid, [(4-fluorophenyl)sulfonyl]-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) (9CI)
CAS:Formula:C14H22FNO7SMolecular weight:367.3904
