CAS 102583-96-0

2-[[2,5-bis(trifluoromethyl)phenyl]amino]benzoic acid

Description:

2-[[2,5-bis(trifluoromethyl)phenyl]amino]benzoic acid, identified by its CAS number 102583-96-0, is an organic compound characterized by its complex structure, which includes both an amino group and a carboxylic acid functional group. This compound features a biphenyl system where one of the phenyl rings is substituted with two trifluoromethyl groups, enhancing its lipophilicity and potentially influencing its reactivity and interaction with biological systems. The presence of the carboxylic acid group suggests that it can participate in hydrogen bonding and may exhibit acidic properties. Additionally, the trifluoromethyl groups are known to impart unique electronic properties, making this compound of interest in various fields, including medicinal chemistry and materials science. Its solubility, stability, and reactivity can be influenced by the presence of these functional groups, making it a candidate for further research in drug development or as a chemical intermediate. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.

Formula: C₁₅H₉F₆NO₂

InChI: InChI=1/C15H9F6NO2/c16-14(17,18)8-5-6-10(15(19,20)21)12(7-8)22-11-4-2-1-3-9(11)13(23)24/h1-7,22H,(H,23,24)

SMILES: c1ccc(c(c1)C(=O)O)Nc1cc(ccc1C(F)(F)F)C(F)(F)F

Synonyms:

• Benzoic acid, 2-[[2,5-bis(trifluoromethyl)phenyl]amino]-

Benzoic acid, 2-[[2,5-bis(trifluoromethyl)phenyl]amino]-

CAS: 102583-96-0

Formula: C₁₅H₉F₆NO₂

Molecular weight: 349.2279

Ref: IN-DA0007TR