CAS 102585-97-7
:4-amino-N-(1-cyclohexylpyrrolidin-3-yl)-N-methylbenzamide (2E)-but-2-enedioate
Description:
4-amino-N-(1-cyclohexylpyrrolidin-3-yl)-N-methylbenzamide (2E)-but-2-enedioate, with the CAS number 102585-97-7, is a chemical compound that features a complex structure characterized by the presence of an amine group, a benzamide moiety, and a cyclohexylpyrrolidine ring. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the amino and carbonyl groups. The presence of the butenedioate moiety suggests that it may participate in various chemical reactions, including esterification or conjugation reactions. Additionally, the cyclohexyl and pyrrolidine components may influence its pharmacological properties, potentially making it relevant in medicinal chemistry. The compound's stereochemistry, indicated by the (2E) configuration, suggests specific spatial arrangements that could affect its biological activity and interactions with receptors. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research chemical.
Formula:C22H31N3O5
InChI:InChI=1/C18H27N3O.C4H4O4/c1-20(18(22)14-7-9-15(19)10-8-14)17-11-12-21(13-17)16-5-3-2-4-6-16;5-3(6)1-2-4(7)8/h7-10,16-17H,2-6,11-13,19H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AHR-5645B fumarate
CAS:AHR-5645B fumarate is a substituted benzamide that has been shown to inhibit 3H-spiperone binding to bovine anterior pituitary membranes.Formula:C22H31N3O5Color and Shape:SolidMolecular weight:417.5
