CymitQuimica logo

CAS 102587-50-8

:

6-chloro-N-cyclobutyl-N'-ethyl-1,3,5-triazine-2,4-diamine

Description:
6-Chloro-N-cyclobutyl-N'-ethyl-1,3,5-triazine-2,4-diamine is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms and three carbon atoms. The presence of a chloro substituent at the 6-position and cyclobutyl and ethyl groups attached to the nitrogen atoms contributes to its unique properties. This compound is typically classified as a herbicide, often utilized in agricultural applications for its ability to inhibit the growth of certain weeds. Its mechanism of action generally involves interference with photosynthesis or other vital metabolic processes in target plants. The compound's solubility, stability, and reactivity can vary based on environmental conditions, making it important for users to understand its behavior in different settings. Safety data sheets and regulatory guidelines should be consulted for handling and application to ensure compliance with safety standards. Overall, this compound exemplifies the diverse functionalities of triazine derivatives in agrochemical applications.
Formula:C9H14ClN5
InChI:InChI=1/C9H14ClN5/c1-2-11-8-13-7(10)14-9(15-8)12-6-4-3-5-6/h6H,2-5H2,1H3,(H2,11,12,13,14,15)
SMILES:CCN=c1nc(Cl)[nH]c(=NC2CCC2)[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.