CAS 1026-04-6: 2-(2-Hydroxyphenyl)-4(3H)-quinazolinone
Description:2-(2-Hydroxyphenyl)-4(3H)-quinazolinone, also known by its CAS number 1026-04-6, is a chemical compound characterized by its quinazolinone core structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the hydroxyl group on the phenyl ring enhances its solubility and reactivity, contributing to its biological interactions. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, influencing its behavior in various chemical environments. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, 2-(2-Hydroxyphenyl)-4(3H)-quinazolinone represents a significant compound in medicinal chemistry with potential applications in drug development.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c17-12-8-4-2-6-10(12)13-15-11-7-3-1-5-9(11)14(18)16-13/h1-8,17H,(H,15,16,18)
InChI key:InChIKey=OVVWPYNVWLHEGE-UHFFFAOYSA-N
SMILES:O=C1N=C(NC=2C=CC=CC12)C=3C=CC=CC3O
- Synonyms:
- ELF 69 alcohol
- 2-(2-Hydroxyphenyl)-4(3H)-quinazolinone
- 4(3H)-Quinazolinone, 2-(2-hydroxyphenyl)-
- 4(3H)-Quinazolinone, 2-(o-hydroxyphenyl)-
- 4(1H)-Quinazolinone, 2-(2-hydroxyphenyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4(3H)-Quinazolinone, 2-(2-hydroxyphenyl)- REF: IN-DA0007W6CAS: 1026-04-6 | - - - | To inquire | Tue 04 Mar 25 |
 | 2-(2-hydroxyphenyl)-1,4-dihydroquinazolin-4-one REF: 10-F732508CAS: 1026-04-6 | 97% | - - - | Discontinued product |
 | 2-(2-Hydroxy-phenyl)-3H-quinazolin-4-one REF: 3D-BAA02604CAS: 1026-04-6 | Min. 95% | - - - | Discontinued product |
2-(2-hydroxyphenyl)-1,4-dihydroquinazolin-4-one
Ref: 10-F732508
| 1g | Discontinued | Request information |
2-(2-Hydroxy-phenyl)-3H-quinazolin-4-one
Ref: 3D-BAA02604
| 5mg | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
