CymitQuimica logo

CAS 1026039-55-3

:

2-Amino-6-ethyl-3-pyridinecarboxylic acid

Description:
2-Amino-6-ethyl-3-pyridinecarboxylic acid, also known by its CAS number 1026039-55-3, is an organic compound that features a pyridine ring substituted with an amino group and a carboxylic acid group. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. The ethyl substituent at the 6-position of the pyridine ring can influence the compound's solubility and reactivity. Additionally, the carboxylic acid group imparts acidic properties, allowing for proton transfer reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its behavior in biological systems and potential therapeutic uses. Overall, 2-Amino-6-ethyl-3-pyridinecarboxylic acid represents a unique structure with potential significance in various chemical and biological contexts.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-2-5-3-4-6(8(11)12)7(9)10-5/h3-4H,2H2,1H3,(H2,9,10)(H,11,12)
InChI key:InChIKey=JYQLWQGCFJEGFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)N=C(CC)C=C1
Synonyms:
  • 2-Amino-6-ethyl-nicotinic acid
  • 2-Amino-6-ethyl-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-amino-6-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.