CAS 102607-24-9

(3β,7β,15α,25R)-3,7,15,20-Tetrahydroxy-11,23-dioxolanost-8-en-26-oic acid

Description:

The chemical substance known as (3β,7β,15α,25R)-3,7,15,20-Tetrahydroxy-11,23-dioxolanost-8-en-26-oic acid, with the CAS number 102607-24-9, is a complex organic compound characterized by its tetracyclic structure, which includes multiple hydroxyl (-OH) groups and a dioxolane ring. This compound is part of the steroid family and exhibits a unique arrangement of functional groups that contribute to its biological activity. The presence of hydroxyl groups suggests potential for hydrogen bonding, influencing solubility and reactivity. The stereochemistry indicated by the specific configuration at various carbon centers plays a crucial role in determining the compound's interaction with biological systems, potentially affecting its pharmacological properties. Additionally, the dioxolanost structure may suggest a role in various biochemical pathways, possibly related to plant or microbial metabolism. Overall, this compound's intricate structure and functional groups make it a subject of interest in fields such as medicinal chemistry and biochemistry, where understanding its properties could lead to applications in drug development or natural product synthesis.

Formula: C₃₀H₄₆O₈

InChI: InChI=1S/C30H46O8/c1-15(25(36)37)10-16(31)13-29(6,38)20-12-22(35)30(7)24-17(32)11-19-26(2,3)21(34)8-9-27(19,4)23(24)18(33)14-28(20,30)5/h15,17,19-22,32,34-35,38H,8-14H2,1-7H3,(H,36,37)/t15-,17+,19+,20-,21+,22+,27+,28-,29+,30+/m1/s1

InChI key: InChIKey=RZBILUATLYXZLI-IMAZOSPNSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@]([C@@](CC(C[C@H](C(O)=O)C)=O)(C)O)(C[C@@H]2O)[H]

Synonyms:

• Lanost-8-en-26-oic acid, 3,7,15,20-tetrahydroxy-11,23-dioxo-, (3β,7β,15α,25R)-
• (3β,7β,15α,25R)-3,7,15,20-Tetrahydroxy-11,23-dioxolanost-8-en-26-oic acid
• Ganoderic acid L

Ganoderic acid L

CAS: 102607-24-9

Ganoderic acid L is a triterpenoid compound, which is a bioactive secondary metabolite sourced from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is primarily isolated from the fruiting body of the mushroom, which has been used in traditional medicine for centuries.

Formula: C₃₀H₄₆O₈

Purity: Min. 95%

Molecular weight: 534.70 g/mol

Ref: 3D-CEA60724