CAS 10261-83-3

2-Methyl-1,5-naphthyridin-4(1H)-one

Description:

2-Methyl-1,5-naphthyridin-4(1H)-one, with the CAS number 10261-83-3, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a naphthyridine moiety. This compound features a methyl group at the 2-position and a carbonyl group at the 4-position of the naphthyridine ring system, contributing to its reactivity and potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in organic solvents, and may show limited solubility in water due to its hydrophobic nature. The presence of the carbonyl group suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may also exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural features allow for various substitutions, which can lead to derivatives with enhanced or altered biological activities. As with many heterocycles, it may also participate in complexation with metal ions, influencing its chemical behavior and applications in coordination chemistry.

Formula: C₉H₈N₂O

InChI: InChI=1S/C9H8N2O/c1-6-5-8(12)9-7(11-6)3-2-4-10-9/h2-5H,1H3,(H,11,12)

InChI key: InChIKey=XHQHBSCUWFTAOM-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(C)=C1)=CC=CN2

Synonyms:

• 2-Methyl-1H-[1,5]naphthyridin-4-one
• 2-Methyl-1,5-naphthyridin-4(1H)-one
• 1,5-Naphthyridin-4(1H)-one, 2-methyl-

1,5-Naphthyridin-4(1H)-one, 2-methyl-

CAS: 10261-83-3

Formula: C₉H₈N₂O

Molecular weight: 160.1726

Ref: IN-DA0007WS