CymitQuimica logo

CAS 102613-15-0

:

Uracil, 3-(3-bromo-4-ethoxybenzyl)-5-fluoro-

Description:
Uracil, 3-(3-bromo-4-ethoxybenzyl)-5-fluoro- is a synthetic derivative of uracil, a pyrimidine nucleobase that plays a crucial role in the synthesis of RNA. This compound features a bromine atom and an ethoxy group attached to a benzyl moiety, along with a fluorine substitution at the 5-position of the uracil ring. The presence of these substituents can significantly influence the compound's biological activity, potentially enhancing its interaction with nucleic acids or other biomolecules. The bromine and fluorine atoms may impart unique electronic properties, while the ethoxy group can affect solubility and lipophilicity. Such modifications are often explored in medicinal chemistry for their potential therapeutic applications, including antiviral or anticancer properties. The compound's structure suggests it may participate in hydrogen bonding and π-π stacking interactions, which are essential for nucleobase recognition in biological systems. Overall, this compound represents a class of modified nucleobases that are of interest for their potential roles in drug development and molecular biology research.
Formula:C13H12BrFN2O3
InChI:InChI=1/C13H12BrFN2O3/c1-2-20-11-4-3-8(5-9(11)14)7-17-12(18)10(15)6-16-13(17)19/h3-6H,2,7H2,1H3,(H,16,19)
SMILES:CCOc1ccc(cc1Br)Cn1c(=O)c(cnc1O)F
Synonyms:
  • 3-(3-Bromo-4-ethoxybenzyl)-5-fluorouracil
  • 3-(3-bromo-4-ethoxybenzyl)-5-fluoropyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.