CymitQuimica logo

CAS 102613-21-8

:

3-[(3-chloro-4-ethoxy-phenyl)methyl]-5-fluoro-1H-pyrimidine-2,4-dione

Description:
3-[(3-chloro-4-ethoxy-phenyl)methyl]-5-fluoro-1H-pyrimidine-2,4-dione, with the CAS number 102613-21-8, is a synthetic organic compound characterized by its pyrimidine core, which features a fluorine atom and a dione functional group. The presence of the ethoxy and chloro substituents on the phenyl ring contributes to its unique chemical properties, influencing its reactivity and potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many synthetic compounds, safety and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound represents a specific class of heterocyclic compounds that may have significant implications in drug development and chemical research.
Formula:C13H12ClFN2O3
InChI:InChI=1/C13H12ClFN2O3/c1-2-20-11-4-3-8(5-9(11)14)7-17-12(18)10(15)6-16-13(17)19/h3-6H,2,7H2,1H3,(H,16,19)
SMILES:CCOc1ccc(cc1Cl)Cn1c(=O)c(cnc1O)F
Synonyms:
  • Uracil, 3-(3-chloro-4-ethoxybenzyl)-5-fluoro-
  • 3-(3-Chloro-4-ethoxybenzyl)-5-fluorouracil
  • 3-(3-chloro-4-ethoxybenzyl)-5-fluoropyrimidine-2,4(1H,3H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.