CAS 102613-24-1
:3-[(3-chloro-4-propoxy-phenyl)methyl]-5-fluoro-1H-pyrimidine-2,4-dione
Description:
3-[(3-chloro-4-propoxy-phenyl)methyl]-5-fluoro-1H-pyrimidine-2,4-dione, with CAS number 102613-24-1, is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic structure containing nitrogen atoms. This compound features a fluorine atom at the 5-position and a chloro-propoxy-substituted phenyl group at the 3-position, contributing to its unique chemical properties. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The chloro and propoxy substituents enhance its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its stability, solubility, and reactivity can be influenced by the substituents, making it a candidate for further investigation in drug design and synthesis.
Formula:C14H14ClFN2O3
InChI:InChI=1/C14H14ClFN2O3/c1-2-5-21-12-4-3-9(6-10(12)15)8-18-13(19)11(16)7-17-14(18)20/h3-4,6-7H,2,5,8H2,1H3,(H,17,20)
SMILES:CCCOc1ccc(cc1Cl)Cn1c(=O)c(cnc1O)F
Synonyms:- Uracil, 3-(3-chloro-4-propoxybenzyl)-5-fluoro-
- 3-(3-Chloro-4-propoxybenzyl)-5-fluorouracil
- 3-(3-chloro-4-propoxybenzyl)-5-fluoropyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4(1H,3H)-Pyrimidinedione, 3-[(3-chloro-4-propoxyphenyl)methyl]-5-fluoro-
CAS:Formula:C14H14ClFN2O3Molecular weight:312.724
