CAS 102623-18-7: β-D-Glucopyranuronic acid, 1-[2-[(2,3-dimethylphenyl)amino]benzoate]
Description:β-D-Glucopyranuronic acid, 1-[2-[(2,3-dimethylphenyl)amino]benzoate] is a chemical compound characterized by its complex structure, which includes a glucuronic acid moiety linked to a benzoate group that is further substituted with a dimethylphenyl amino group. This compound features a glucuronic acid unit, which is a sugar acid derived from glucose, known for its role in various biological processes, including detoxification and metabolism. The presence of the dimethylphenyl amino group suggests potential applications in medicinal chemistry, possibly as a drug or a biochemical probe. The compound's structure indicates it may exhibit specific interactions with biological targets, influenced by the aromatic and polar functional groups. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. As with many derivatives of glucuronic acid, it may also participate in conjugation reactions, which are significant in pharmacokinetics and biochemistry. Further studies would be necessary to elucidate its specific properties and potential applications.
Formula:C21H23NO8
InChI:InChI=1S/C21H23NO8/c1-10-6-5-9-13(11(10)2)22-14-8-4-3-7-12(14)20(28)30-21-17(25)15(23)16(24)18(29-21)19(26)27/h3-9,15-18,21-25H,1-2H3,(H,26,27)/t15-,16-,17+,18-,21-/m0/s1
InChI key:InChIKey=DAHIGOGKMFBIOR-CURYNPBISA-N
SMILES:O=C(O)C1OC(OC(=O)C=2C=CC=CC2NC3=CC=CC(=C3C)C)C(O)C(O)C1O
- Synonyms:
- 1-O-(2-(2,3-dimethylphenyl)aminobenzoyl)glucopyranuronic acid
- 1-O-{2-[(2,3-dimethylphenyl)amino]benzoyl}-beta-D-glucopyranuronic acid
- 1-[2-[(2,3-Dimethylphenyl)amino]benzoate] -D-Glucopyranuronic Acid
- 1-[2-[(2,3-Dimethylphenyl)amino]benzoate] b-D-Glucopyranuronic Acid
- Mefenamic Acid Glucuronide
- Mefenamic Acyl--D-glucuronide
- β-<span class="text-smallcaps">D</span>-Glucopyranuronic acid, 1-[2-[(2,3-dimethylphenyl)amino]benzoate]
- β-D-Glucopyranuronic acid, 1-[2-[(2,3-dimethylphenyl)amino]benzoate]