CymitQuimica logo

CAS 102624-97-5

:

1-Nitroso-3-azetidinecarboxylic acid

Description:
1-Nitroso-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a nitroso group (-NO) and an azetidine ring, a four-membered cyclic amine. This compound typically exhibits properties associated with both its carboxylic acid functional group and the presence of the nitroso moiety, which can influence its reactivity and stability. The azetidine ring contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the nitroso group may impart specific reactivity, such as the ability to participate in various chemical transformations, including nitration and oxidation reactions. Additionally, the compound's solubility and behavior in different solvents can vary, which is important for its applications in research and industry. Overall, 1-Nitroso-3-azetidinecarboxylic acid is of interest in the field of organic chemistry due to its structural features and potential reactivity.
Formula:C4H6N2O3
InChI:InChI=1S/C4H6N2O3/c7-4(8)3-1-6(2-3)5-9/h3H,1-2H2,(H,7,8)
InChI key:InChIKey=LOKLKVWDANNUKQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(N=O)C1
Synonyms:
  • 1-Nitroso-3-azetidinecarboxylic acid
  • 3-Azetidinecarboxylic acid, 1-nitroso-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.