CymitQuimica logo

CAS 102626-54-0

:

2,3,5,6-Tetramethyl-α-(trifluoromethyl)benzenemethanol

Description:
2,3,5,6-Tetramethyl-α-(trifluoromethyl)benzenemethanol is an organic compound characterized by its complex structure, which includes a benzene ring substituted with multiple methyl groups and a trifluoromethyl group. This compound features a hydroxymethyl group (-CH2OH) attached to the benzene, contributing to its classification as an alcohol. The presence of the trifluoromethyl group enhances its chemical stability and influences its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The multiple methyl substituents increase the compound's hydrophobicity and steric hindrance, which can affect its solubility and interaction with biological systems. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can modify the compound's behavior in chemical reactions. Overall, 2,3,5,6-Tetramethyl-α-(trifluoromethyl)benzenemethanol is a notable compound in organic chemistry due to its distinctive structural features and potential applications.
Formula:C12H15F3O
InChI:InChI=1S/C12H15F3O/c1-6-5-7(2)9(4)10(8(6)3)11(16)12(13,14)15/h5,11,16H,1-4H3
InChI key:InChIKey=MTXZTQSOORAJNF-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=C(C)C(C)=CC(C)=C1C
Synonyms:
  • 2,2,2-Trifluoro-1-(2,3,5,6-tetramethylphenyl)ethan-1-ol
  • Benzenemethanol, 2,3,5,6-tetramethyl-α-(trifluoromethyl)-
  • 2,3,5,6-Tetramethyl-α-(trifluoromethyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.