CAS 102630-86-4
:3-amino-N-(2,3-dimethylphenyl)benzamide
Description:
3-Amino-N-(2,3-dimethylphenyl)benzamide is an organic compound characterized by its amine and amide functional groups. It features a benzene ring substituted with an amino group at the meta position and an amide group linked to a 2,3-dimethylphenyl moiety. This structure contributes to its potential as a pharmaceutical intermediate or in various chemical syntheses. The presence of the dimethyl groups on the phenyl ring can influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic rings and polar functional groups, which can affect its interactions in biological systems. Additionally, its molecular structure may allow for hydrogen bonding, impacting its physical properties such as melting and boiling points. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c1-10-5-3-8-14(11(10)2)17-15(18)12-6-4-7-13(16)9-12/h3-9H,16H2,1-2H3,(H,17,18)
SMILES:Cc1cccc(c1C)N=C(c1cccc(c1)N)O
Synonyms:- benzamide, 3-amino-N-(2,3-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
