
CAS 102631-05-0
:N-(2,5-Dimethylphenyl)-3-nitrobenzamide
Description:
N-(2,5-Dimethylphenyl)-3-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a nitro group and an amide functional group. The presence of the 2,5-dimethylphenyl moiety contributes to its hydrophobic characteristics, while the nitro group introduces polarity and potential reactivity. This compound typically exhibits a solid state at room temperature and may have moderate solubility in organic solvents, depending on the specific solvent properties. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the nitro group, which can participate in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the methyl groups on the aromatic ring. Safety and handling precautions should be observed, as nitro compounds can be sensitive to heat and shock, and may pose environmental hazards. Overall, N-(2,5-Dimethylphenyl)-3-nitrobenzamide is a compound of interest in synthetic organic chemistry and material science.
Formula:C15H14N2O3
InChI:InChI=1S/C15H14N2O3/c1-10-6-7-11(2)14(8-10)16-15(18)12-4-3-5-13(9-12)17(19)20/h3-9H,1-2H3,(H,16,18)
InChI key:InChIKey=ZCFJRZKXKWLSNG-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC(N(=O)=O)=CC=C1)C2=C(C)C=CC(C)=C2
Synonyms:- Benzamide, N-(2,5-dimethylphenyl)-3-nitro-
- N-(2,5-Dimethylphenyl)-3-nitrobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.