CAS 102632-29-1

N''-{(1E)-[4-(diethylamino)phenyl]methylidene}carbonohydrazonic diamide

Description:

N''-{(1E)-[4-(diethylamino)phenyl]methylidene}carbonohydrazonic diamide, identified by its CAS number 102632-29-1, is a chemical compound characterized by its complex structure, which includes a hydrazone functional group. This compound features a diethylamino group, contributing to its potential as a base and influencing its solubility and reactivity. The presence of the carbonohydrazonic moiety suggests it may exhibit properties typical of hydrazones, such as potential tautomerism and reactivity towards electrophiles. The compound's structure indicates it may be involved in various chemical reactions, including condensation and substitution reactions, making it of interest in synthetic organic chemistry. Additionally, the diethylamino group may impart biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization. Overall, this compound exemplifies the diverse chemistry associated with hydrazones and their derivatives.

Formula: C₁₂H₁₉N₅

InChI: InChI=1/C12H19N5/c1-3-17(4-2)11-7-5-10(6-8-11)9-15-16-12(13)14/h5-9H,3-4H2,1-2H3,(H4,13,14,16)/b15-9+

Hydrazinecarboximidamide, 2-[[4-(diethylamino)phenyl]methylene]-

CAS: 102632-29-1

Formula: C₁₂H₁₉N₅

Molecular weight: 233.3128

Ref: IN-DA000800