CAS 102636-82-8: Glutarylcarnitine
Description:Glutarylcarnitine, with the CAS number 102636-82-8, is a derivative of carnitine, which plays a crucial role in the transport of fatty acids into the mitochondria for energy production. This compound is characterized by the presence of a glutaryl group attached to the carnitine backbone, which influences its biochemical properties and functions. Glutarylcarnitine is primarily involved in metabolic processes, particularly in the context of fatty acid metabolism and energy homeostasis. It is often studied in relation to certain metabolic disorders, including those affecting fatty acid oxidation. The substance is typically found in biological fluids and tissues, and its levels can be indicative of specific metabolic conditions. In terms of solubility, glutarylcarnitine is generally soluble in water, which facilitates its biological activity. Its role in cellular metabolism and potential implications in health and disease make it a subject of interest in clinical and biochemical research.
Formula:C12H21NO6
InChI:InChI=1S/C12H21NO6/c1-13(2,3)8-9(7-11(16)17)19-12(18)6-4-5-10(14)15/h9H,4-8H2,1-3H3,(H-,14,15,16,17)/t9-/m1/s1
InChI key:InChIKey=NXJAXUYOQLTISD-SECBINFHSA-N
SMILES:O=C([O-])CC(OC(=O)CCCC(=O)O)C[N+](C)(C)C
- Synonyms:
- 1-Propanaminium, 3-carboxy-2-(4-carboxy-1-oxobutoxy)-N,N,N-trimethyl-, inner salt, (2R)-
- 1-Propanaminium, 3-carboxy-2-(4-carboxy-1-oxobutoxy)-N,N,N-trimethyl-, inner salt, (R)-
- Glutaroyl N-(methyl-D3)-carnitine
- Glutarylcarnitine
