
CAS 102639-80-5
:Homoserine, O-(phenylmethyl)-, methyl ester, hydrochloride
Description:
Homoserine, O-(phenylmethyl)-, methyl ester, hydrochloride is a chemical compound characterized by its structure, which includes a homoserine backbone modified with a phenylmethyl (benzyl) group and a methyl ester functional group. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and methanol due to the presence of the hydrochloride salt form. The presence of the methyl ester enhances its lipophilicity, which can influence its biological activity and interactions. Homoserine derivatives are often studied for their potential applications in pharmaceuticals and biochemistry, particularly in the context of amino acid metabolism and as intermediates in the synthesis of various bioactive compounds. The hydrochloride form indicates that the compound is a salt, which can affect its stability and solubility properties. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C12H17NO3·ClH
InChI:InChI=1S/C12H17NO3.ClH/c1-15-12(14)11(13)7-8-16-9-10-5-3-2-4-6-10;/h2-6,11H,7-9,13H2,1H3;1H
InChI key:InChIKey=NUWNHEQZQWCWMR-UHFFFAOYSA-N
SMILES:C(OCCC(C(OC)=O)N)C1=CC=CC=C1.Cl
Synonyms:- DL-Homoserine, O-(phenylmethyl)-, methyl ester, hydrochloride
- Homoserine, O-(phenylmethyl)-, methyl ester, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.